10-Oxylatoacridine-10-ium structure
|
Common Name | 10-Oxylatoacridine-10-ium | ||
|---|---|---|---|---|
| CAS Number | 10399-73-2 | Molecular Weight | 195.21700 | |
| Density | 1.18g/cm3 | Boiling Point | 392.3ºC at 760 mmHg | |
| Molecular Formula | C13H9NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191ºC | |
| Name | 10-oxidoacridin-10-ium |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 392.3ºC at 760 mmHg |
| Molecular Formula | C13H9NO |
| Molecular Weight | 195.21700 |
| Flash Point | 191ºC |
| Exact Mass | 195.06800 |
| PSA | 25.46000 |
| LogP | 3.42150 |
| Vapour Pressure | 5.25E-06mmHg at 25°C |
| Index of Refraction | 1.645 |
| InChIKey | HYGIWTYYBBTQAL-UHFFFAOYSA-N |
| SMILES | [O-][n+]1c2ccccc2cc2ccccc21 |
| HS Code | 2933990090 |
|---|
|
~61%
10-Oxylatoacrid... CAS#:10399-73-2 |
| Literature: Balsarini, Christian; Novo, Barbara; Resnati, Giuseppe Journal of Fluorine Chemistry, 1996 , vol. 80, # 1 p. 31 - 34 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Acridine,10-oxide |
| 9-Aza-anthracen-N-oxid |
| Acridin-10-oxid |
| Acridine-N-oxide |
| HMS2222K13 |
| Acridin-10-oxyd |