9-ANTHRYLDIAZOMETHANE structure
|
Common Name | 9-ANTHRYLDIAZOMETHANE | ||
|---|---|---|---|---|
| CAS Number | 10401-59-9 | Molecular Weight | 218.25300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10N2 | Melting Point | 65-67°C (lit.) | |
| MSDS | N/A | Flash Point | N/A | |
Use of 9-ANTHRYLDIAZOMETHANE9-Anthryldiazomethane is a fluorescent labeling reagent, which can be used for detecting fatty acids and derivatives[1]. |
| Name | 9-Anthryldiazomethane |
|---|---|
| Synonym | More Synonyms |
| Description | 9-Anthryldiazomethane is a fluorescent labeling reagent, which can be used for detecting fatty acids and derivatives[1]. |
|---|---|
| Related Catalog | |
| References |
| Melting Point | 65-67°C (lit.) |
|---|---|
| Molecular Formula | C15H10N2 |
| Molecular Weight | 218.25300 |
| Exact Mass | 218.08400 |
| PSA | 37.39000 |
| LogP | 3.72276 |
| InChIKey | XXDVOJKRZBNPFN-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=Cc1c2ccccc2cc2ccccc12 |
| Storage condition | 20°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| HS Code | 2927000090 |
|
~63%
9-ANTHRYLDIAZOM... CAS#:10401-59-9 |
| Literature: Hoer, Katja; Gimple, Olaf; Schreier, Peter; Humpf, Hans-Ulrich Journal of Organic Chemistry, 1998 , vol. 63, # 2 p. 322 - 325 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 9-(diazomethyl)anthracene |
| 9-Anthryldiazomethane |
| Anthracene, 9-(Diazomethyl)- |