3β-Hydroxy-Δ5.16-pregnadienon-(20)
3β-Hydroxy-Δ5.16-pregnadienon-(20) structure
|
Common Name | 3β-Hydroxy-Δ5.16-pregnadienon-(20) | ||
|---|---|---|---|---|
| CAS Number | 104010-41-5 | Molecular Weight | 314.46200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H30O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3β-Hydroxy-Δ5.16-pregnadienon-(20) |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H30O2 |
|---|---|
| Molecular Weight | 314.46200 |
| Exact Mass | 314.22500 |
| PSA | 37.30000 |
| LogP | 4.43540 |
| InChIKey | YLFRRPUBVUAHSR-AKYPRQFMSA-N |
| SMILES | CC(=O)C1=CCC2C3CC=C4CC(O)CCC4(C)C3CCC12C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:1096-38-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Δ5,16-Pregnandienol-3β-on-(20) |
| 3β-Hydroxy-20-oxo-pregnadien-(5.16) |
| 3β-Hydroxy-pregna-5,16-dien-20-on |
| 3β-Hydroxy-pregna-5.16-dien |
| 16-Dehydro-pregnenolon |
| 16-Dihydropregnenolon |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 3β-Hydroxy-Δ5.16-pregnadienon-(20)? |
| A: Polar surface area (PSA) of 3β-Hydroxy-Δ5.16-pregnadienon-(20) is 37.30000. |
| Q: What is the SMILES notation of 3β-Hydroxy-Δ5.16-pregnadienon-(20)? |
| A: SMILES notation of 3β-Hydroxy-Δ5.16-pregnadienon-(20) is CC(=O)C1=CCC2C3CC=C4CC(O)CCC4(C)C3CCC12C. |
| Q: What English synonyms does 3β-Hydroxy-Δ5.16-pregnadienon-(20) have? |
| A: English synonyms of 3β-Hydroxy-Δ5.16-pregnadienon-(20): Δ5,16-Pregnandienol-3β-on-(20), 3β-Hydroxy-20-oxo-pregnadien-(5.16), 3β-Hydroxy-pregna-5,16-dien-20-on, 3β-Hydroxy-pregna-5.16-dien, 16-Dehydro-pregnenolon, 16-Dihydropregnenolon. |
| Q: What is the English name of 3β-Hydroxy-Δ5.16-pregnadienon-(20)? |
| A: The English name of 3β-Hydroxy-Δ5.16-pregnadienon-(20) is 3β-Hydroxy-Δ5.16-pregnadienon-(20). |
| Q: What is the molecular formula of 3β-Hydroxy-Δ5.16-pregnadienon-(20)? |
| A: Molecular formula of 3β-Hydroxy-Δ5.16-pregnadienon-(20) is C21H30O2. |
| Q: What is the LogP of 3β-Hydroxy-Δ5.16-pregnadienon-(20)? |
| A: LogP of 3β-Hydroxy-Δ5.16-pregnadienon-(20) is 4.43540. |
| Q: What is the InChIKey of 3β-Hydroxy-Δ5.16-pregnadienon-(20)? |
| A: InChIKey of 3β-Hydroxy-Δ5.16-pregnadienon-(20) is YLFRRPUBVUAHSR-AKYPRQFMSA-N. |
| Q: What is the molecular weight of 3β-Hydroxy-Δ5.16-pregnadienon-(20)? |
| A: Molecular weight of 3β-Hydroxy-Δ5.16-pregnadienon-(20) is 314.46200. |
| Q: What is the CAS number of 3β-Hydroxy-Δ5.16-pregnadienon-(20)? |
| A: CAS number of 3β-Hydroxy-Δ5.16-pregnadienon-(20) is 104010-41-5. |
| Q: What is the Chinese name of 104010-41-5? |
| A: Chinese name of 104010-41-5 is 104010-41-5. |