16-Dehydroprogesterone structure
|
Common Name | 16-Dehydroprogesterone | ||
|---|---|---|---|---|
| CAS Number | 1096-38-4 | Molecular Weight | 312.44600 | |
| Density | 1.1g/cm3 | Boiling Point | 461ºC at 760mmHg | |
| Molecular Formula | C21H28O2 | Melting Point | 185-187 °C(lit.) | |
| MSDS | N/A | Flash Point | 171.5ºC | |
Use of 16-Dehydroprogesterone16-Dehydroprogesterone is a steroidal progestin. |
| Name | 16,17-didehydroprogesterone |
|---|---|
| Synonym | More Synonyms |
| Description | 16-Dehydroprogesterone is a steroidal progestin. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1g/cm3 |
|---|---|
| Boiling Point | 461ºC at 760mmHg |
| Melting Point | 185-187 °C(lit.) |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.44600 |
| Flash Point | 171.5ºC |
| Exact Mass | 312.20900 |
| PSA | 34.14000 |
| LogP | 4.64360 |
| Vapour Pressure | 1.11E-08mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | VRRHHTISESGZFN-RKFFNLMFSA-N |
| SMILES | CC(=O)C1=CCC2C3CCC4=CC(=O)CCC4(C)C3CCC12C |
| Storage condition | 2-8°C |
| Hazard Codes | Xn: Harmful; |
|---|---|
| Risk Phrases | R20/21/22;R40 |
| Safety Phrases | S22-S36 |
| WGK Germany | 3 |
| Precursor 7 | |
|---|---|
| DownStream 10 | |
| (8R,9S,10R,13S,14S)-17-acetyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one |
| 3,20-Dioxopregna-4,16-diene |
| EINECS 214-142-8 |
| Pregnadien-(4.16)-dion-(3.20) |
| 4,16-pregnadiene-3,20-dione |
| delta4,16-Pregnadiene-3,20-dione |
| 16,17-Didehydroprogesterone |
| Pregna-4,16-diene-3,20-dione |
| 16-Dehydroprogesterone |
| pregna-4,16-dien-3,20-dione |
| Pregna-4,20-dione |
| Pregna-4,16-dien-3,20-dion |
| MFCD00003651 |