2-Bromo-5-nitroaniline structure
|
Common Name | 2-Bromo-5-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 10403-47-1 | Molecular Weight | 217.020 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 334.5±22.0 °C at 760 mmHg | |
| Molecular Formula | C6H5BrN2O2 | Melting Point | 139-141 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 156.1±22.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Bromo-5-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 334.5±22.0 °C at 760 mmHg |
| Melting Point | 139-141 °C(lit.) |
| Molecular Formula | C6H5BrN2O2 |
| Molecular Weight | 217.020 |
| Flash Point | 156.1±22.3 °C |
| Exact Mass | 215.953430 |
| PSA | 71.84000 |
| LogP | 2.46 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.670 |
| InChIKey | BAAUCXCLMDAZEL-UHFFFAOYSA-N |
| SMILES | Nc1cc([N+](=O)[O-])ccc1Br |
| Water Solubility | slightly soluble |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2921420090 |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Synthesis and biological evaluation of A-ring biaryl-carbamate analogues of rhazinilam.
Bioorg. Med. Chem. 10(11) , 3395-400, (2002) An improvement of the synthesis of biphenyl-carbamate 2a, the most active analogue of rhazinilam 1 so far, was performed using the Pd-catalyzed borylation/Suzuki coupling (BSC) method developed in our... |
|
|
Formation and rearrangement of ipso intermediates in aromatic free-radical chlorination reactions. Everly CR and Traynham JG.
J. Org. Chem. 44(11) , 1784-1787, (1979)
|
|
|
An intramolecular palladium-catalysed aryl amination reaction to produce benzimidazoles. Brain CT and Brunton SA.
Tetrahedron Lett. 43(10) , 1893-95, (2002)
|
| 2-Bromo-5-nitro aniline |
| Benzenamine,2-bromo-5-nitro |
| 2-bromo-5-nitrophenylamine |
| EINECS 233-874-9 |
| 2-Brom-5-nitro-anilin |
| 4-nitro-2-aminobromobenzene |
| Benzenamine, 2-bromo-5-nitro- |
| 2-Bromo-5-nitroaniline |
| 6-bromo-3-nitroaniline |
| MFCD00051578 |