4-(Bromomethyl)-2,6-pyridinedicarboxylic Acid 2,6-Dimethyl Ester structure
|
Common Name | 4-(Bromomethyl)-2,6-pyridinedicarboxylic Acid 2,6-Dimethyl Ester | ||
|---|---|---|---|---|
| CAS Number | 1040401-17-9 | Molecular Weight | 288.09500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dimethyl 4-(bromomethyl)pyridine-2,6-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H10BrNO4 |
|---|---|
| Molecular Weight | 288.09500 |
| Exact Mass | 286.97900 |
| PSA | 65.49000 |
| LogP | 1.54970 |
| InChIKey | GXXFUVXRBZYXMZ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(CBr)cc(C(=O)OC)n1 |
|
~%
4-(Bromomethyl)... CAS#:1040401-17-9 |
| Literature: Journal of the American Chemical Society, , vol. 130, # 32 p. 10486 - 10487 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 2,6-dimethoxycarbonyl-4-bromomethylpyridine |