4-Mercaptomethyl Dipicolinic Acid structure
|
Common Name | 4-Mercaptomethyl Dipicolinic Acid | ||
|---|---|---|---|---|
| CAS Number | 1040401-18-0 | Molecular Weight | 213.21000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(sulfanylmethyl)pyridine-2,6-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H7NO4S |
|---|---|
| Molecular Weight | 213.21000 |
| Exact Mass | 213.01000 |
| PSA | 126.29000 |
| LogP | 0.90780 |
| InChIKey | WSVZILXOOFJPGD-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(CS)cc(C(=O)O)n1 |
|
~97%
4-Mercaptomethy... CAS#:1040401-18-0 |
| Literature: Su, Xun-Cheng; Man, Bradley; Beeren, Sophie; Liang, Haobo; Simonsen, Shane; Schmitz, Christophe; Huber, Thomas; Messerle, Barbara A.; Otting, Gottfried Journal of the American Chemical Society, 2008 , vol. 130, # 32 p. 10486 - 10487 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-MMDPA |
| 4-mercaptomethyl-2,6-pyridinedicarboxylic acid |
| 4-Mercaptomethyl Dipicolinic Acid |