Ethyl 3-{[4-(diethylamino)benzyl]amino}propanoate
Modify Date: 2025-09-13 16:11:59
![Ethyl 3-{[4-(diethylamino)benzyl]amino}propanoate Structure](https://image.chemsrc.com/caspic/104/1040688-26-3.png)
Ethyl 3-{[4-(diethylamino)benzyl]amino}propanoate structure
|
Common Name | Ethyl 3-{[4-(diethylamino)benzyl]amino}propanoate | ||
|---|---|---|---|---|
| CAS Number | 1040688-26-3 | Molecular Weight | 278.39000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H26N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 3-{[4-(diethylamino)benzyl]amino}propanoate |
|---|
| Molecular Formula | C16H26N2O2 |
|---|---|
| Molecular Weight | 278.39000 |
| Exact Mass | 278.19900 |
| PSA | 41.57000 |
| LogP | 2.96650 |
| InChIKey | IZJCAHXKXUKDSG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCNCc1ccc(N(CC)CC)cc1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |