ethyl 3-(4-hydroxyphenyl)-2-[(2-phenylmethoxycarbonylaminoacetyl)amino]propanoate structure
|
Common Name | ethyl 3-(4-hydroxyphenyl)-2-[(2-phenylmethoxycarbonylaminoacetyl)amino]propanoate | ||
|---|---|---|---|---|
| CAS Number | 3249-01-2 | Molecular Weight | 400.42500 | |
| Density | 1.255g/cm3 | Boiling Point | 653.5ºC at 760 mmHg | |
| Molecular Formula | C21H24N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 349ºC | |
| Name | ethyl 3-(4-hydroxyphenyl)-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]propanoate |
|---|
| Density | 1.255g/cm3 |
|---|---|
| Boiling Point | 653.5ºC at 760 mmHg |
| Molecular Formula | C21H24N2O6 |
| Molecular Weight | 400.42500 |
| Flash Point | 349ºC |
| Exact Mass | 400.16300 |
| PSA | 113.96000 |
| LogP | 2.69080 |
| Index of Refraction | 1.574 |
| InChIKey | FPTMTBBQLBSTFG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cc1ccc(O)cc1)NC(=O)CNC(=O)OCc1ccccc1 |
| HS Code | 2924299090 |
|---|
| Precursor 7 | |
|---|---|
| DownStream 4 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |