tert-Butyl-2,6-diazaspiro[3.3]heptan-2-carboxylat structure
|
Common Name | tert-Butyl-2,6-diazaspiro[3.3]heptan-2-carboxylat | ||
|---|---|---|---|---|
| CAS Number | 1041026-70-3 | Molecular Weight | 198.262 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 282.6±40.0 °C at 760 mmHg | |
| Molecular Formula | C10H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 124.7±27.3 °C | |
| Name | tert-Butyl 2,6-diazaspiro[3.3]heptane-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 282.6±40.0 °C at 760 mmHg |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.262 |
| Flash Point | 124.7±27.3 °C |
| Exact Mass | 198.136826 |
| PSA | 41.57000 |
| LogP | 0.62 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.525 |
| InChIKey | KVOUHLVOTMOJBS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(CNC2)C1 |
| HS Code | 2933990090 |
|---|
|
~96%
tert-Butyl-2,6-... CAS#:1041026-70-3 |
| Literature: Firooznia, Fariborz; Lin, Tai-An; So, Sung-Sau; Wang, Baoxia; Yun, Hong Ying Patent: US2010/125061 A1, 2010 ; Location in patent: Page/Page column 20 ; US 20100125061 A1 |
|
~%
tert-Butyl-2,6-... CAS#:1041026-70-3 |
| Literature: Organic Letters, , vol. 10, # 16 p. 3525 - 3526 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Methyl-2-propanyl 2,6-diazaspiro[3.3]heptane-2-carboxylate |
| tert-butyl 2,6-diazaspiro[3.3]heptane-2-carboxylate |
| tert-Butyl-2,6-diazaspiro[3.3]heptan-2-carboxylat |
| 2,6-Diazaspiro[3.3]heptane-2-carboxylic acid, 1,1-dimethylethyl ester |
| tert-Butyl 2,6-diazaspiro[3.3]heptane-2-carboxylate oxalate |