3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline
3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline structure
|
Common Name | 3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline | ||
|---|---|---|---|---|
| CAS Number | 104147-32-2 | Molecular Weight | 278.03100 | |
| Density | 1.558 | Boiling Point | 305ºC | |
| Molecular Formula | C8H5Cl2F4NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.558 |
|---|---|
| Boiling Point | 305ºC |
| Molecular Formula | C8H5Cl2F4NO |
| Molecular Weight | 278.03100 |
| Flash Point | 138ºC |
| Exact Mass | 276.96800 |
| PSA | 35.25000 |
| LogP | 4.39350 |
| Vapour Pressure | 0.000834mmHg at 25°C |
| Index of Refraction | 1.496 |
| InChIKey | JIPDPVQPKLVDIU-UHFFFAOYSA-N |
| SMILES | Nc1cc(Cl)c(OC(F)(F)C(F)F)c(Cl)c1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xn: Harmful;N: Dangerous for the environment; |
|---|---|
| Risk Phrases | R22 |
| Safety Phrases | 24/25-26-57-60-61 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the safety information for 3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline? |
| A: Safety information for 3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline: 24/25-26-57-60-61. |
| Q: What is the molecular formula of 3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline? |
| A: Molecular formula of 3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline is C8H5Cl2F4NO. |
| Q: What is the SMILES notation of 3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline? |
| A: SMILES notation of 3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline is Nc1cc(Cl)c(OC(F)(F)C(F)F)c(Cl)c1. |
| Q: What is the English name of 3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline? |
| A: The English name of 3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline is 3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline. |
| Q: What is the InChIKey of 3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline? |
| A: InChIKey of 3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline is JIPDPVQPKLVDIU-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline? |
| A: Molecular weight of 3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline is 278.03100. |
| Q: What is the polar surface area (PSA) of 3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline? |
| A: Polar surface area (PSA) of 3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline is 35.25000. |
| Q: What is the CAS number of 3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline? |
| A: CAS number of 3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline is 104147-32-2. |
| Q: What is the LogP of 3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline? |
| A: LogP of 3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline is 4.39350. |
| Q: What is the boiling point of 3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline? |
| A: Boiling point of 3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline is 305ºC. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |