hc yellow no. 7 structure
|
Common Name | hc yellow no. 7 | ||
|---|---|---|---|---|
| CAS Number | 104226-21-3 | Molecular Weight | 314.38200 | |
| Density | 1.2g/cm3 | Boiling Point | 578.8ºC at 760 mmHg | |
| Molecular Formula | C17H22N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 303.8ºC | |
| Name | 2-[4-[(4-aminophenyl)diazenyl]-N-(2-hydroxyethyl)-3-methylanilino]ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 578.8ºC at 760 mmHg |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.38200 |
| Flash Point | 303.8ºC |
| Exact Mass | 314.17400 |
| PSA | 94.44000 |
| LogP | 3.36480 |
| Vapour Pressure | 3.09E-14mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | YSVKKVUAUKQDBY-UHFFFAOYSA-N |
| SMILES | Cc1cc(N(CCO)CCO)ccc1N=Nc1ccc(N)cc1 |
| HS Code | 2927000090 |
|---|
|
~%
hc yellow no. 7 CAS#:104226-21-3 |
| Literature: Bioorganic Chemistry, , vol. 29, # 5 p. 259 - 270 |
|
~%
hc yellow no. 7 CAS#:104226-21-3 |
| Literature: Bioorganic Chemistry, , vol. 29, # 5 p. 259 - 270 |
|
~%
hc yellow no. 7 CAS#:104226-21-3 |
| Literature: Journal of the American Chemical Society, , vol. 63, p. 3236 |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| (4-Amino-phenyl)-(4-[bis-(2-hydroxy-aethyl)-amino]-2-methyl-phenyl]-diazen |
| 4'-Amino-4-[bis-(2-hydroxy-aethyl)-amino]-2-methyl-azobenzol |
| 3-methyl-4-(4'-anilino-azo)-N,N-bis(2-hydroxyethyl)aniline |
| HC Yellow 7 |
| Ethanol,2,2'-[[4-[2-(4-aminophenyl)diazenyl]-3-methylphenyl]imino]bis |
| (4-amino-phenyl)-(4-[bis-(2-hydroxy-ethyl)-amino]-2-methyl-phenyl]-diazene |
| 2,2'-({4-[(e)-(4-aminophenyl)diazenyl]-3-methylphenyl}imino)diethanol |