HC YELLOW NO. 9 structure
|
Common Name | HC YELLOW NO. 9 | ||
|---|---|---|---|---|
| CAS Number | 86419-69-4 | Molecular Weight | 247.67900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H14ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N'-(5-methoxy-2-nitrophenyl)ethane-1,2-diamine,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H14ClN3O3 |
|---|---|
| Molecular Weight | 247.67900 |
| Exact Mass | 247.07200 |
| PSA | 93.10000 |
| LogP | 3.07250 |
| InChIKey | AFAJYBYVKUTWJK-UHFFFAOYSA-N |
| SMILES | COc1ccc([N+](=O)[O-])c(NCCN)c1.Cl |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| HC Yellow no. 9 |
| UNII-91P0Z9H61V |
| Ethylenediamine,N-(5-methoxy-2-nitrophenyl)-,hydrochloride |
| 1,2-Ethanediamine,n1-(5-methoxy-2-nitrophenyl)-,hydrochloride (1:1) |
| 1,2-Ethanediamine,N-(5-methoxy-2-nitrophenyl)-,monohydrochloride |
| Imexine FAD |
| HC Yellow 9 |