6-Amino-N-methyl-2-naphthalenesulfonamide
6-Amino-N-methyl-2-naphthalenesulfonamide structure
|
Common Name | 6-Amino-N-methyl-2-naphthalenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 104295-55-8 | Molecular Weight | 236.290 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 466.8±37.0 °C at 760 mmHg | |
| Molecular Formula | C11H12N2O2S | Melting Point | 157-163ºC | |
| MSDS | N/A | Flash Point | 236.1±26.5 °C | |
Summary: 2-萘胺-6-磺酰甲胺 (2-Naphthylamine-6-sulfonmethylamide, CAS: 104295-55-8), with molecular formula C11H12N2O2S and molecular weight 236.290. Appearance: brown, melting point: 157-163ºC, density: 1.3±0.1 g/cm3. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Naphthylamine-6-sulfonmethylamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 466.8±37.0 °C at 760 mmHg |
| Melting Point | 157-163ºC |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.290 |
| Flash Point | 236.1±26.5 °C |
| Exact Mass | 236.061951 |
| PSA | 80.57000 |
| LogP | 0.92 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.659 |
| InChIKey | RBQODZRXIYFUJS-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)c1ccc2cc(N)ccc2c1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xn:Harmful;N:Dangerousfortheenvironment; |
|---|---|
| Risk Phrases | R43;R48/22;R51/53 |
| Safety Phrases | S2-S22-S36/37-S61 |
| HS Code | 2935009090 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 6-Amino-N-methylnaphthalene-2-sulfonamide |
| MFCD02684427 |
| EINECS 412-120-4 |
| 6-Amino-N-methyl-2-naphthalenesulfonamide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 2-Naphthylamine-6-sulfonmethylamide? |
| A: Boiling point of 2-Naphthylamine-6-sulfonmethylamide is 466.8±37.0 °C at 760 mmHg. |
| Q: What is the English name of 2-Naphthylamine-6-sulfonmethylamide? |
| A: The English name of 2-Naphthylamine-6-sulfonmethylamide is 2-Naphthylamine-6-sulfonmethylamide. |
| Q: What is the molecular weight of 2-Naphthylamine-6-sulfonmethylamide? |
| A: Molecular weight of 2-Naphthylamine-6-sulfonmethylamide is 236.290. |
| Q: What is the SMILES notation of 2-Naphthylamine-6-sulfonmethylamide? |
| A: SMILES notation of 2-Naphthylamine-6-sulfonmethylamide is CNS(=O)(=O)c1ccc2cc(N)ccc2c1. |
| Q: What is the melting point of 2-Naphthylamine-6-sulfonmethylamide? |
| A: Melting point of 2-Naphthylamine-6-sulfonmethylamide is 157-163ºC. |
| Q: What English synonyms does 2-Naphthylamine-6-sulfonmethylamide have? |
| A: English synonyms of 2-Naphthylamine-6-sulfonmethylamide: 6-Amino-N-methylnaphthalene-2-sulfonamide, MFCD02684427, EINECS 412-120-4, 6-Amino-N-methyl-2-naphthalenesulfonamide. |
| Q: What is the LogP of 2-Naphthylamine-6-sulfonmethylamide? |
| A: LogP of 2-Naphthylamine-6-sulfonmethylamide is 0.92. |
| Q: What is the InChIKey of 2-Naphthylamine-6-sulfonmethylamide? |
| A: InChIKey of 2-Naphthylamine-6-sulfonmethylamide is RBQODZRXIYFUJS-UHFFFAOYSA-N. |
| Q: What is the safety information for 2-Naphthylamine-6-sulfonmethylamide? |
| A: Safety information for 2-Naphthylamine-6-sulfonmethylamide: S2-S22-S36/37-S61. |
| Q: What is the polar surface area (PSA) of 2-Naphthylamine-6-sulfonmethylamide? |
| A: Polar surface area (PSA) of 2-Naphthylamine-6-sulfonmethylamide is 80.57000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |
| Henan Tianfu Chemical Co., Ltd. |