s(-)-1-(pentafluorophenyl)ethanol structure
|
Common Name | s(-)-1-(pentafluorophenyl)ethanol | ||
|---|---|---|---|---|
| CAS Number | 104371-20-2 | Molecular Weight | 212.11700 | |
| Density | 1.498g/cm3 | Boiling Point | 162.9ºC at 760mmHg | |
| Molecular Formula | C8H5F5O | Melting Point | 41-42ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 87.2ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (1S)-1-(2,3,4,5,6-pentafluorophenyl)ethanol |
|---|
| Density | 1.498g/cm3 |
|---|---|
| Boiling Point | 162.9ºC at 760mmHg |
| Melting Point | 41-42ºC(lit.) |
| Molecular Formula | C8H5F5O |
| Molecular Weight | 212.11700 |
| Flash Point | 87.2ºC |
| Exact Mass | 212.02600 |
| PSA | 20.23000 |
| LogP | 2.43540 |
| Vapour Pressure | 1.46mmHg at 25°C |
| Index of Refraction | 1.44 |
| InChIKey | WYUNHWKTLDBPLE-REOHCLBHSA-N |
| SMILES | CC(O)c1c(F)c(F)c(F)c(F)c1F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2906299090 |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |