[tert-butyl(dimethyl)silyl] 2,2,2-trifluoroacetate structure
|
Common Name | [tert-butyl(dimethyl)silyl] 2,2,2-trifluoroacetate | ||
|---|---|---|---|---|
| CAS Number | 104410-90-4 | Molecular Weight | 228.28400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H15F3O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [tert-butyl(dimethyl)silyl] 2,2,2-trifluoroacetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H15F3O2Si |
|---|---|
| Molecular Weight | 228.28400 |
| Exact Mass | 228.07900 |
| PSA | 26.30000 |
| LogP | 3.09710 |
| InChIKey | WOMMBEYPWVELIE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC(=O)C(F)(F)F |
|
~%
[tert-butyl(dim... CAS#:104410-90-4 |
| Literature: Dietze, Paul E. Journal of Organic Chemistry, 1992 , vol. 57, # 3 p. 1042 - 1045 |
|
~%
[tert-butyl(dim... CAS#:104410-90-4 |
| Literature: Dietze, Paul E. Journal of Organic Chemistry, 1992 , vol. 57, # 3 p. 1042 - 1045 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| tert-butyldimethylsilyl trifluoroacetate |
| t-Butyldimethylsilyl triflate |
| tert-butyldimethylsilyl trifluoromethanesulfonate |