tert-butyldimethylsilyl trichloroacetate structure
|
Common Name | tert-butyldimethylsilyl trichloroacetate | ||
|---|---|---|---|---|
| CAS Number | 108613-05-4 | Molecular Weight | 277.64800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H15Cl3O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [tert-butyl(dimethyl)silyl] 2,2,2-trichloroacetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H15Cl3O2Si |
|---|---|
| Molecular Weight | 277.64800 |
| Exact Mass | 275.99100 |
| PSA | 26.30000 |
| LogP | 3.90500 |
| InChIKey | BCRSOMADFWLHEK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC(=O)C(Cl)(Cl)Cl |
| RIDADR | UN 1760 |
|---|---|
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2931900090 |
|
~83%
tert-butyldimet... CAS#:108613-05-4 |
| Literature: Galan, Adam A.; Lee, Thomas V.; Chapleo, Christopher B. Tetrahedron Letters, 1986 , vol. 27, # 41 p. 4995 - 4998 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| TERT-BUTYLDIMETHYLSILYL TRICHLOROACETATE |
| Acetic acid,trichloro-,(1,1-dimethylethyl)dimethylsilyl ester |
| Aceticacid,trichloro-,(1,1-dimethylethyl)dimethylsilyl ester (9CI) |
| Acetic acid,2,2,2-trichloro-,(1,1-dimethylethyl)dimethylsilyl ester |
| t-butyldimethylsilyl trichloroacetate |