calcium,bis(2-ethylhexyl) phosphate structure
|
Common Name | calcium,bis(2-ethylhexyl) phosphate | ||
|---|---|---|---|---|
| CAS Number | 10442-05-4 | Molecular Weight | 682.90300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H68CaO8P2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | calcium,bis(2-ethylhexyl) phosphate |
|---|
| Molecular Formula | C32H68CaO8P2 |
|---|---|
| Molecular Weight | 682.90300 |
| Exact Mass | 682.40200 |
| PSA | 136.80000 |
| LogP | 11.98200 |
| InChIKey | DMYIMYPKMVWFOS-UHFFFAOYSA-L |
| SMILES | CCCCC(CC)COP(=O)([O-])OCC(CC)CCCC.CCCCC(CC)COP(=O)([O-])OCC(CC)CCCC.[Ca+2] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn |
| Risk Phrases | 22-36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
|
Modeling of divalent/monovalent ion selectivity of ion-exchanger-based solvent polymeric membranes doped with coexchanger
Anal. Chem. 72 , 4965, (2000) It is shown that the addition of a coexchanger does not always improve the selectivity of an ion-selective electrode. As a model case, the selectivity toward divalent primary ions I2+ in the presence ... |