(+/-)-7,8-DIHYDROXY-3-ALLYL-1-PHENYL-2,3,4,5-TETRAHYDRO-1H-3-BENZAZEPINE HYDROBROMIDE structure
|
Common Name | (+/-)-7,8-DIHYDROXY-3-ALLYL-1-PHENYL-2,3,4,5-TETRAHYDRO-1H-3-BENZAZEPINE HYDROBROMIDE | ||
|---|---|---|---|---|
| CAS Number | 104422-04-0 | Molecular Weight | 376.28700 | |
| Density | 1.157g/cm3 | Boiling Point | 470.4ºC at 760mmHg | |
| Molecular Formula | C19H22BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.5ºC | |
| Name | N-allyl-1-phenyl-2,3,4,5-tetrahydro-3-benzazepine-7,8-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.157g/cm3 |
|---|---|
| Boiling Point | 470.4ºC at 760mmHg |
| Molecular Formula | C19H22BrNO2 |
| Molecular Weight | 376.28700 |
| Flash Point | 245.5ºC |
| Exact Mass | 375.08300 |
| PSA | 43.70000 |
| LogP | 4.16980 |
| Vapour Pressure | 1.8E-09mmHg at 25°C |
| InChIKey | QBUVZVXIRYFENV-UHFFFAOYSA-N |
| SMILES | C=CCN1CCc2cc(O)c(O)cc2C(c2ccccc2)C1 |
| WGK Germany | 3 |
|---|---|
| HS Code | 2933990090 |
|
~%
(+/-)-7,8-DIHYD... CAS#:104422-04-0 |
| Literature: Neumeyer, John L.; Baindur, Nandkishore; Niznik, Hyman B.; Guan, H. C.; Seeman, Philip Journal of Medicinal Chemistry, 1991 , vol. 34, # 12 p. 3366 - 3371 |
|
~%
(+/-)-7,8-DIHYD... CAS#:104422-04-0 |
| Literature: Ross, Stephen T.; Franz, Robert G.; Gallagher, Gregory; Brenner, Martin; Wilson, James W.; et al. Journal of Medicinal Chemistry, 1987 , vol. 30, # 1 p. 35 - 40 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-allyl-7,8-dihydroxy-1-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepine |
| 3-allyl-1-phenyl-2,3,4,5-tetrahydro-1h-3-benzazepine-7,8-diol |
| 3-Allyl-2,3,4,5-tetrahydro-7,8-dihydroxy-1-phenyl-1H-3-benzazepine |
| 5-phenyl-3-prop-2-enyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol |
| 3-allyl-2,3,4,5-tetrahydro-1-phenyl-1H-3-benzazepine-7,8-diol |