2-acetylsulfanyl-3-phenylprop-2-enoic acid structure
|
Common Name | 2-acetylsulfanyl-3-phenylprop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 104484-08-4 | Molecular Weight | 222.26000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-acetylsulfanyl-3-phenylprop-2-enoic acid |
|---|
| Molecular Formula | C11H10O3S |
|---|---|
| Molecular Weight | 222.26000 |
| Exact Mass | 222.03500 |
| PSA | 79.67000 |
| LogP | 2.39180 |
| InChIKey | FYKXSBQPXOLKOJ-UHFFFAOYSA-N |
| SMILES | CC(=O)SC(=Cc1ccccc1)C(=O)O |
|
~89%
2-acetylsulfany... CAS#:104484-08-4 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , p. 2417 - 2424 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |