2-phenoxy-3-phenylprop-2-enoic acid structure
|
Common Name | 2-phenoxy-3-phenylprop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 58954-64-6 | Molecular Weight | 240.25400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-phenoxy-3-phenylprop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H12O3 |
|---|---|
| Molecular Weight | 240.25400 |
| Exact Mass | 240.07900 |
| PSA | 46.53000 |
| LogP | 3.19110 |
| InChIKey | PTOUKUHRSZKAQU-UHFFFAOYSA-N |
| SMILES | O=C(O)C(=Cc1ccccc1)Oc1ccccc1 |
|
~%
2-phenoxy-3-phe... CAS#:58954-64-6 |
| Literature: Papa; Schwenk Journal of the American Chemical Society, 1947 , vol. 69, p. 3022 |
|
~%
2-phenoxy-3-phe... CAS#:58954-64-6 |
| Literature: Groeger; Waldmann Monatshefte fuer Chemie, 1958 , vol. 89, p. 370,373 |
| 2-Propenoic acid,2-phenoxy-3-phenyl-,(Z) |
| (Z)-2-phenoxy-3-phenylacrylic acid |