bis(2,2,2-trifluoroethyl) 2-methylidenebutanedioate structure
|
Common Name | bis(2,2,2-trifluoroethyl) 2-methylidenebutanedioate | ||
|---|---|---|---|---|
| CAS Number | 104534-96-5 | Molecular Weight | 294.14800 | |
| Density | 1.389g/cm3 | Boiling Point | 227.1ºC at 760 mmHg | |
| Molecular Formula | C9H8F6O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 88.7ºC | |
| Name | bis(2,2,2-trifluoroethyl) 2-methylidenebutanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.389g/cm3 |
|---|---|
| Boiling Point | 227.1ºC at 760 mmHg |
| Molecular Formula | C9H8F6O4 |
| Molecular Weight | 294.14800 |
| Flash Point | 88.7ºC |
| Exact Mass | 294.03300 |
| PSA | 52.60000 |
| LogP | 2.14370 |
| Vapour Pressure | 0.0791mmHg at 25°C |
| Index of Refraction | 1.369 |
| InChIKey | IRXUFAGEXMCXHZ-UHFFFAOYSA-N |
| SMILES | C=C(CC(=O)OCC(F)(F)F)C(=O)OCC(F)(F)F |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2917190090 |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| pc4759 |