ethyl 2-(2-benzoyl-4-chloroanilino)acetate structure
|
Common Name | ethyl 2-(2-benzoyl-4-chloroanilino)acetate | ||
|---|---|---|---|---|
| CAS Number | 10456-86-7 | Molecular Weight | 317.76700 | |
| Density | 1.261g/cm3 | Boiling Point | 485.4ºC at 760mmHg | |
| Molecular Formula | C17H16ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.4ºC | |
| Name | ethyl 2-(2-benzoyl-4-chloroanilino)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.261g/cm3 |
|---|---|
| Boiling Point | 485.4ºC at 760mmHg |
| Molecular Formula | C17H16ClNO3 |
| Molecular Weight | 317.76700 |
| Flash Point | 247.4ºC |
| Exact Mass | 317.08200 |
| PSA | 55.40000 |
| LogP | 3.61900 |
| Vapour Pressure | 1.41E-09mmHg at 25°C |
| Index of Refraction | 1.6 |
| InChIKey | DDABQRMXCYUDFT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNc1ccc(Cl)cc1C(=O)c1ccccc1 |
|
~%
ethyl 2-(2-benz... CAS#:10456-86-7 |
| Literature: Kulkarni; Sharma; Dua Journal of the Indian Chemical Society, 1987 , vol. 64, # 1 p. 46 - 48 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2-N-carbethoxymethyl-5-chlorobenzophenone |