2-(2-benzoyl-4-chloroanilino)acetohydrazide structure
|
Common Name | 2-(2-benzoyl-4-chloroanilino)acetohydrazide | ||
|---|---|---|---|---|
| CAS Number | 111044-20-3 | Molecular Weight | 303.74400 | |
| Density | 1.349g/cm3 | Boiling Point | 605.8ºC at 760mmHg | |
| Molecular Formula | C15H14ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 320.2ºC | |
| Name | 2-(2-benzoyl-4-chloroanilino)acetohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.349g/cm3 |
|---|---|
| Boiling Point | 605.8ºC at 760mmHg |
| Molecular Formula | C15H14ClN3O2 |
| Molecular Weight | 303.74400 |
| Flash Point | 320.2ºC |
| Exact Mass | 303.07700 |
| PSA | 87.71000 |
| LogP | 3.58640 |
| Vapour Pressure | 1.26E-14mmHg at 25°C |
| Index of Refraction | 1.652 |
| InChIKey | KONLDBGNSFLMBT-UHFFFAOYSA-N |
| SMILES | NNC(=O)CNc1ccc(Cl)cc1C(=O)c1ccccc1 |
|
~%
2-(2-benzoyl-4-... CAS#:111044-20-3 |
| Literature: Kulkarni; Sharma; Dua Journal of the Indian Chemical Society, 1987 , vol. 64, # 1 p. 46 - 48 |
|
~%
2-(2-benzoyl-4-... CAS#:111044-20-3 |
| Literature: Kulkarni; Sharma; Dua Journal of the Indian Chemical Society, 1987 , vol. 64, # 1 p. 46 - 48 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Glycine,N-(2-benzoyl-4-chlorophenyl)-,hydrazide |
| N-(2-Benzoyl-4-chlorophenyl)glycine hydrazide |
| 2-(hydrazinocarbonyl)methylamino-5-chlorobenzophenone |