2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl 3,4,5-trimethoxybenzoate structure
|
Common Name | 2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl 3,4,5-trimethoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 104575-36-2 | Molecular Weight | 365.33800 | |
| Density | 1.33g/cm3 | Boiling Point | 520.9ºC at 760mmHg | |
| Molecular Formula | C16H19N3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 268.8ºC | |
| Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 3,4,5-trimethoxybenzoate |
|---|
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 520.9ºC at 760mmHg |
| Molecular Formula | C16H19N3O7 |
| Molecular Weight | 365.33800 |
| Flash Point | 268.8ºC |
| Exact Mass | 365.12200 |
| PSA | 117.63000 |
| LogP | 2.50570 |
| Vapour Pressure | 5.99E-11mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | SVTLMDWAMSAFIE-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)OCCn2c([N+](=O)[O-])cnc2C)cc(OC)c1OC |
| HS Code | 2933290090 |
|---|
|
~73%
2-(2-Methyl-5-n... CAS#:104575-36-2 |
| Literature: Walsh; Wang; Bagan; Wislocki; Miwa Journal of Medicinal Chemistry, 1987 , vol. 30, # 1 p. 150 - 156 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |