(1,3-DIOXO-3,4-DIHYDROISOQUINOLIN-2(1H)-YL)ACETICACID
(1,3-DIOXO-3,4-DIHYDROISOQUINOLIN-2(1H)-YL)ACETICACID structure
|
Common Name | (1,3-DIOXO-3,4-DIHYDROISOQUINOLIN-2(1H)-YL)ACETICACID | ||
|---|---|---|---|---|
| CAS Number | 104575-39-5 | Molecular Weight | 171.15400 | |
| Density | 1.46g/cm3 | Boiling Point | 382.6ºC at 760mmHg | |
| Molecular Formula | C6H9N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1,4-dimethyl-5-nitroimidazol-2-yl)methanol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 382.6ºC at 760mmHg |
| Molecular Formula | C6H9N3O3 |
| Molecular Weight | 171.15400 |
| Flash Point | 185.2ºC |
| Exact Mass | 171.06400 |
| PSA | 83.87000 |
| LogP | 0.65220 |
| Vapour Pressure | 1.54E-06mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | QFCZUXUHKLYQKW-UHFFFAOYSA-N |
| SMILES | Cc1nc(CO)n(C)c1[N+](=O)[O-] |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2933290090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~77%
(1,3-DIOXO-3,4-... CAS#:104575-39-5 |
| Literature: Walsh; Wang; Bagan; Wislocki; Miwa Journal of Medicinal Chemistry, 1987 , vol. 30, # 1 p. 150 - 156 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,4-Dimethyl-5-nitro-1H-imidazole-2-methanol |
| 1,4-dimethyl-2-hydroxymethyl-5-nitroimidazole |
| 1H-Imidazole-2-methanol,1,4-dimethyl-5-nitro |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (1,4-dimethyl-5-nitroimidazol-2-yl)methanol? |
| A: CAS number of (1,4-dimethyl-5-nitroimidazol-2-yl)methanol is 104575-39-5. |
| Q: What is the LogP of (1,4-dimethyl-5-nitroimidazol-2-yl)methanol? |
| A: LogP of (1,4-dimethyl-5-nitroimidazol-2-yl)methanol is 0.65220. |
| Q: What is the boiling point of (1,4-dimethyl-5-nitroimidazol-2-yl)methanol? |
| A: Boiling point of (1,4-dimethyl-5-nitroimidazol-2-yl)methanol is 382.6ºC at 760mmHg. |
| Q: What is the InChIKey of (1,4-dimethyl-5-nitroimidazol-2-yl)methanol? |
| A: InChIKey of (1,4-dimethyl-5-nitroimidazol-2-yl)methanol is QFCZUXUHKLYQKW-UHFFFAOYSA-N. |
| Q: What is the molecular weight of (1,4-dimethyl-5-nitroimidazol-2-yl)methanol? |
| A: Molecular weight of (1,4-dimethyl-5-nitroimidazol-2-yl)methanol is 171.15400. |
| Q: What is the English name of (1,4-dimethyl-5-nitroimidazol-2-yl)methanol? |
| A: The English name of (1,4-dimethyl-5-nitroimidazol-2-yl)methanol is (1,4-dimethyl-5-nitroimidazol-2-yl)methanol. |
| Q: What is the molecular formula of (1,4-dimethyl-5-nitroimidazol-2-yl)methanol? |
| A: Molecular formula of (1,4-dimethyl-5-nitroimidazol-2-yl)methanol is C6H9N3O3. |
| Q: What English synonyms does (1,4-dimethyl-5-nitroimidazol-2-yl)methanol have? |
| A: English synonyms of (1,4-dimethyl-5-nitroimidazol-2-yl)methanol: 1,4-Dimethyl-5-nitro-1H-imidazole-2-methanol, 1,4-dimethyl-2-hydroxymethyl-5-nitroimidazole, 1H-Imidazole-2-methanol,1,4-dimethyl-5-nitro. |
| Q: What is the polar surface area (PSA) of (1,4-dimethyl-5-nitroimidazol-2-yl)methanol? |
| A: Polar surface area (PSA) of (1,4-dimethyl-5-nitroimidazol-2-yl)methanol is 83.87000. |
| Q: What is the SMILES notation of (1,4-dimethyl-5-nitroimidazol-2-yl)methanol? |
| A: SMILES notation of (1,4-dimethyl-5-nitroimidazol-2-yl)methanol is Cc1nc(CO)n(C)c1[N+](=O)[O-]. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |