(1,3-DIOXO-3,4-DIHYDROISOQUINOLIN-2(1H)-YL)ACETICACID structure
|
Common Name | (1,3-DIOXO-3,4-DIHYDROISOQUINOLIN-2(1H)-YL)ACETICACID | ||
|---|---|---|---|---|
| CAS Number | 104575-39-5 | Molecular Weight | 171.15400 | |
| Density | 1.46g/cm3 | Boiling Point | 382.6ºC at 760mmHg | |
| Molecular Formula | C6H9N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.2ºC | |
| Name | (1,4-dimethyl-5-nitroimidazol-2-yl)methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 382.6ºC at 760mmHg |
| Molecular Formula | C6H9N3O3 |
| Molecular Weight | 171.15400 |
| Flash Point | 185.2ºC |
| Exact Mass | 171.06400 |
| PSA | 83.87000 |
| LogP | 0.65220 |
| Vapour Pressure | 1.54E-06mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | QFCZUXUHKLYQKW-UHFFFAOYSA-N |
| SMILES | Cc1nc(CO)n(C)c1[N+](=O)[O-] |
| HS Code | 2933290090 |
|---|
|
~77%
(1,3-DIOXO-3,4-... CAS#:104575-39-5 |
| Literature: Walsh; Wang; Bagan; Wislocki; Miwa Journal of Medicinal Chemistry, 1987 , vol. 30, # 1 p. 150 - 156 |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,4-Dimethyl-5-nitro-1H-imidazole-2-methanol |
| 1,4-dimethyl-2-hydroxymethyl-5-nitroimidazole |
| 1H-Imidazole-2-methanol,1,4-dimethyl-5-nitro |