tert-butyl N-(5-methoxy-4-prop-2-enylpyridin-3-yl)carbamate structure
|
Common Name | tert-butyl N-(5-methoxy-4-prop-2-enylpyridin-3-yl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 1045859-16-2 | Molecular Weight | 264.32000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20N2O3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | tert-butyl N-(5-methoxy-4-prop-2-enylpyridin-3-yl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H20N2O3 |
|---|---|
| Molecular Weight | 264.32000 |
| Exact Mass | 264.14700 |
| PSA | 60.45000 |
| LogP | 3.23870 |
| InChIKey | UAKZRZZYGKNUBZ-UHFFFAOYSA-N |
| SMILES | C=CCc1c(NC(=O)OC(C)(C)C)cncc1OC |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| A-5900 |
| tert-butyl N-[5-methoxy-4-(prop-2-en-1-yl)pyridin-3-yl]carbamate |
| tert-Butyl 4-allyl-5-methoxypyridin-3-ylcarbamate |