3,5,6-tripyridin-2-yl-1,2,4-triazine structure
|
Common Name | 3,5,6-tripyridin-2-yl-1,2,4-triazine | ||
|---|---|---|---|---|
| CAS Number | 1046-57-7 | Molecular Weight | 312.32800 | |
| Density | 1.276g/cm3 | Boiling Point | 550.9ºC at 760 mmHg | |
| Molecular Formula | C18H12N6 | Melting Point | 186ºC | |
| MSDS | N/A | Flash Point | 253.1ºC | |
| Name | 3,5,6-tripyridin-2-yl-1,2,4-triazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.276g/cm3 |
|---|---|
| Boiling Point | 550.9ºC at 760 mmHg |
| Melting Point | 186ºC |
| Molecular Formula | C18H12N6 |
| Molecular Weight | 312.32800 |
| Flash Point | 253.1ºC |
| Exact Mass | 312.11200 |
| PSA | 77.34000 |
| LogP | 3.05760 |
| Vapour Pressure | 1.27E-11mmHg at 25°C |
| Index of Refraction | 1.644 |
| InChIKey | JGMBVEZRZJNYAG-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2nnc(-c3ccccn3)c(-c3ccccn3)n2)nc1 |
| HS Code | 2933990090 |
|---|
|
~80%
3,5,6-tripyridi... CAS#:1046-57-7 |
| Literature: Pabst, Gunther R.; Schmid, Konrad; Sauer, Juergen Tetrahedron Letters, 1998 , vol. 39, # 37 p. 6691 - 6694 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Triazine analog |