Di-2-pyridylglyoxal
Di-2-pyridylglyoxal structure
|
Common Name | Di-2-pyridylglyoxal | ||
|---|---|---|---|---|
| CAS Number | 492-73-9 | Molecular Weight | 212.20400 | |
| Density | 1.271 g/cm3 | Boiling Point | 400ºC at 760 mmHg | |
| Molecular Formula | C12H8N2O2 | Melting Point | 154-156 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 198.2ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2-dipyridin-2-ylethane-1,2-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.271 g/cm3 |
|---|---|
| Boiling Point | 400ºC at 760 mmHg |
| Melting Point | 154-156 °C(lit.) |
| Molecular Formula | C12H8N2O2 |
| Molecular Weight | 212.20400 |
| Flash Point | 198.2ºC |
| Exact Mass | 212.05900 |
| PSA | 59.92000 |
| LogP | 1.54220 |
| Vapour Pressure | 1.31E-06mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | PIINXYKJQGMIOZ-UHFFFAOYSA-N |
| SMILES | O=C(C(=O)c1ccccn1)c1ccccn1 |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 10 | |
CAS#:1141-06-6
CAS#:1121-60-4
CAS#:1115-15-7
CAS#:3891-65-4![2,2'-BIPYRIDINE]-6-CARBALDEHYDE Structure](https://image.chemsrc.com/caspic/066/134296-07-4.png)
CAS#:134296-07-4
CAS#:586-98-1
CAS#:109-06-8
CAS#:41661-47-6![3,3'-Bi[1,2,3]triazolo[1,5-a]pyridine structure](https://image.chemsrc.com/caspic/266/59742-90-4.png)
CAS#:59742-90-4![Methanone,2-pyridinyl[1,2,3]triazolo[1,5-a]pyridin-3-yl structure](https://image.chemsrc.com/caspic/069/10554-49-1.png)
CAS#:10554-49-1
CAS#:1046-57-7
CAS#:98-98-6![pyridine-2-carboxylic acid-(2-oxo-1,2-di-[2]pyridyl-ethylamide) structure](https://image.chemsrc.com/caspic/358/111531-11-4.png)
CAS#:111531-11-4
CAS#:23309-74-2
CAS#:25005-95-2
CAS#:14050-01-2
CAS#:100899-17-0
CAS#:2459-07-6This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Di-2-pyridylglyoxal |
| EINECS 207-759-9 |
| Ethanedione,di-2-pyridinyl |
| 1,2-bis(pyridin-2-yl)ethane-1,2-dione |
| Bipicolinoyl |
| 2,2'-Pyridil |
| 1,2-bis-(2-pyridyl)-ethane-1,2-dione |
| Glyoxal,di-2-pyridyl |
| 1,2-di(2-pyridyl)ethane-1,2-dione |
| 1,2-di(pyridin-2-yl)-ethane-1,2-dione |
| 2,2'-ETHYLENEDIANILINE |
| MFCD00006301 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1,2-dipyridin-2-ylethane-1,2-dione? |
| A: The English name of 1,2-dipyridin-2-ylethane-1,2-dione is 1,2-dipyridin-2-ylethane-1,2-dione. |
| Q: What is the boiling point of 1,2-dipyridin-2-ylethane-1,2-dione? |
| A: Boiling point of 1,2-dipyridin-2-ylethane-1,2-dione is 400ºC at 760 mmHg. |
| Q: What is the molecular formula of 1,2-dipyridin-2-ylethane-1,2-dione? |
| A: Molecular formula of 1,2-dipyridin-2-ylethane-1,2-dione is C12H8N2O2. |
| Q: What is the polar surface area (PSA) of 1,2-dipyridin-2-ylethane-1,2-dione? |
| A: Polar surface area (PSA) of 1,2-dipyridin-2-ylethane-1,2-dione is 59.92000. |
| Q: What is the LogP of 1,2-dipyridin-2-ylethane-1,2-dione? |
| A: LogP of 1,2-dipyridin-2-ylethane-1,2-dione is 1.54220. |
| Q: What is the safety information for 1,2-dipyridin-2-ylethane-1,2-dione? |
| A: Safety information for 1,2-dipyridin-2-ylethane-1,2-dione: S26-S36/37. |
| Q: What are the upstream materials of 1,2-dipyridin-2-ylethane-1,2-dione? |
| A: Related upstream materials(CAS) of 1,2-dipyridin-2-ylethane-1,2-dione: 1141-06-6;1121-60-4;1115-15-7;3891-65-4;134296-07-4;586-98-1;109-06-8;41661-47-6. |
| Q: What is the melting point of 1,2-dipyridin-2-ylethane-1,2-dione? |
| A: Melting point of 1,2-dipyridin-2-ylethane-1,2-dione is 154-156 °C(lit.). |
| Q: What is the CAS number of 1,2-dipyridin-2-ylethane-1,2-dione? |
| A: CAS number of 1,2-dipyridin-2-ylethane-1,2-dione is 492-73-9. |
| Q: What is the SMILES notation of 1,2-dipyridin-2-ylethane-1,2-dione? |
| A: SMILES notation of 1,2-dipyridin-2-ylethane-1,2-dione is O=C(C(=O)c1ccccn1)c1ccccn1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |