Benzene,1,2,3,4,5-pentachloro-6-ethoxy- structure
|
Common Name | Benzene,1,2,3,4,5-pentachloro-6-ethoxy- | ||
|---|---|---|---|---|
| CAS Number | 10463-10-2 | Molecular Weight | 294.39000 | |
| Density | 1.551g/cm3 | Boiling Point | 335.4ºC at 760mmHg | |
| Molecular Formula | C8H5Cl5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.4ºC | |
| Name | 1,2,3,4,5-pentachloro-6-ethoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.551g/cm3 |
|---|---|
| Boiling Point | 335.4ºC at 760mmHg |
| Molecular Formula | C8H5Cl5O |
| Molecular Weight | 294.39000 |
| Flash Point | 128.4ºC |
| Exact Mass | 291.87800 |
| PSA | 9.23000 |
| LogP | 5.35230 |
| Vapour Pressure | 0.000233mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | YXNDWTIYDLVODL-UHFFFAOYSA-N |
| SMILES | CCOc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Pentachlorphenyl-ethylether |
| 2,3,4,5,6-pentachloro-phenetole |
| Benzene,pentachloroethoxy |
| 2.3.4.5.6-Pentachlor-1-aethoxy-benzol |
| 2,3,4,5,6-Pentachlorphenetol |
| Pentachloroethoxy-benzene |