Benzene,1,2,3,4,5-pentachloro-6-ethyl- structure
|
Common Name | Benzene,1,2,3,4,5-pentachloro-6-ethyl- | ||
|---|---|---|---|---|
| CAS Number | 606-07-5 | Molecular Weight | 278.39000 | |
| Density | 1.545g/cm3 | Boiling Point | 287.5ºC at 760 mmHg | |
| Molecular Formula | C8H5Cl5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 125.3ºC | |
| Name | 1,2,3,4,5-pentachloro-6-ethylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.545g/cm3 |
|---|---|
| Boiling Point | 287.5ºC at 760 mmHg |
| Molecular Formula | C8H5Cl5 |
| Molecular Weight | 278.39000 |
| Flash Point | 125.3ºC |
| Exact Mass | 275.88300 |
| LogP | 5.51600 |
| Index of Refraction | 1.575 |
| InChIKey | JBLPFPMLHWDSFR-UHFFFAOYSA-N |
| SMILES | CCc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
|
~%
Benzene,1,2,3,4... CAS#:606-07-5 |
| Literature: White; Biggs; Morgan Journal of the American Chemical Society, 1940 , vol. 62, p. 16,23 |
|
~%
Benzene,1,2,3,4... CAS#:606-07-5 |
| Literature: Istrati Annales de Chimie (Cachan, France), 1885 , vol. <6> 6, p. 477,483 |
|
~%
Benzene,1,2,3,4... CAS#:606-07-5 |
| Literature: Harvey et al. Journal of Applied Chemistry, 1954 , vol. 4, p. 325,328 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 1,2,3,4,5-PENTACHLORO-6-ETHYL-BENZENE |
| Pentachlor-aethyl-benzol |
| 2,3,4,5,6-Pentachlor-1-aethyl-benzol |
| ethylpentachlorobenzene |
| PENTACHLOROETHYLBENZENE |
| Aethyl-pentachlor-benzol |
| Pentachlorphenyl-ethan |