[(Oxido)phenyl(trifluoromethyl)-lambda4-sulfanylidene]dimethylammonium Tetrafluoroborate structure
|
Common Name | [(Oxido)phenyl(trifluoromethyl)-lambda4-sulfanylidene]dimethylammonium Tetrafluoroborate | ||
|---|---|---|---|---|
| CAS Number | 1046786-08-6 | Molecular Weight | 325.05500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11BF7NOS | Melting Point | 85-90℃ | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-[dimethylazaniumylidene(trifluoromethyl)-λ4-sulfanyl]phenolate,tetrafluoroborate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 85-90℃ |
|---|---|
| Molecular Formula | C9H11BF7NOS |
| Molecular Weight | 325.05500 |
| Exact Mass | 325.05400 |
| PSA | 28.46000 |
| LogP | 4.47110 |
| InChIKey | JQIUQSKIGNTITL-UHFFFAOYSA-N |
| SMILES | CN(C)[S+](=O)(c1ccccc1)C(F)(F)F.F[B-](F)(F)F |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | UN 1759 8/PG III |
| Packaging Group | III |
| HS Code | 29309090 |
|
Inherent oxygen preference in enolate monofluoromethylation and a synthetic entry to monofluoromethyl ethers.
Angew. Chem. Int. Ed. Engl. 8th ed., 50 , 1885-1889, (2011)
|
| [(Oxido)phenyl(trifluoroMethyl)-laMbda4-sulfanylidene]diMethylaMMoniuM Tetrafluoroborate |