cadmium dioleate structure
|
Common Name | cadmium dioleate | ||
|---|---|---|---|---|
| CAS Number | 10468-30-1 | Molecular Weight | 675.31800 | |
| Density | N/A | Boiling Point | 360ºC at 760 mmHg | |
| Molecular Formula | C36H66CdO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.1ºC | |
| Name | cadmium(2+),(Z)-octadec-9-enoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 360ºC at 760 mmHg |
|---|---|
| Molecular Formula | C36H66CdO4 |
| Molecular Weight | 675.31800 |
| Flash Point | 270.1ºC |
| Exact Mass | 676.39900 |
| PSA | 80.26000 |
| LogP | 9.54510 |
| Vapour Pressure | 3.7E-06mmHg at 25°C |
| InChIKey | ZTSAVNXIUHXYOY-CVBJKYQLSA-L |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)[O-].CCCCCCCCC=CCCCCCCCC(=O)[O-].[Cd+2] |
| HS Code | 2916150000 |
|---|
|
~%
cadmium dioleate CAS#:10468-30-1 |
| Literature: Anderson, Nicholas C.; Hendricks, Mark P.; Choi, Joshua J.; Owen, Jonathan S. Journal of the American Chemical Society, 2013 , vol. 135, # 49 p. 18536 - 18548 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2916150000 |
|---|---|
| Summary | 2916150000 oleic, linoleic or linolenic acids, their salts and esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Oelsaeure,Cadmiumoleat |
| Cadmium dioleate |
| oleic acid,cadmium oleate |
| EINECS 233-954-3 |
| cadmium oleate |