[4-methoxy-2-[4-(4-methylpiperazin-1-yl)-4-oxo-1-phenylbutyl]phenyl] acetate structure
|
Common Name | [4-methoxy-2-[4-(4-methylpiperazin-1-yl)-4-oxo-1-phenylbutyl]phenyl] acetate | ||
|---|---|---|---|---|
| CAS Number | 104712-26-7 | Molecular Weight | 410.50600 | |
| Density | 1.143g/cm3 | Boiling Point | 568.2ºC at 760mmHg | |
| Molecular Formula | C24H30N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 297.4ºC | |
| Name | [4-methoxy-2-[4-(4-methylpiperazin-1-yl)-4-oxo-1-phenylbutyl]phenyl] acetate |
|---|
| Density | 1.143g/cm3 |
|---|---|
| Boiling Point | 568.2ºC at 760mmHg |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.50600 |
| Flash Point | 297.4ºC |
| Exact Mass | 410.22100 |
| PSA | 59.08000 |
| LogP | 3.18240 |
| Vapour Pressure | 6.33E-13mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | GYWRWVVQXMIPOW-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC(C)=O)c(C(CCC(=O)N2CCN(C)CC2)c2ccccc2)c1 |
|
~%
[4-methoxy-2-[4... CAS#:104712-26-7 |
| Literature: Miyano; Tatsuoka; Suzuki; Imao; Satoh; Ishihara; Hirotsu; Kihara; Hatta; Horikawa; Sumoto Chemical and Pharmaceutical Bulletin, 1990 , vol. 38, # 6 p. 1570 - 1574 |
|
~%
[4-methoxy-2-[4... CAS#:104712-26-7 |
| Literature: Miyano; Tatsuoka; Suzuki; Imao; Satoh; Ishihara; Hirotsu; Kihara; Hatta; Horikawa; Sumoto Chemical and Pharmaceutical Bulletin, 1990 , vol. 38, # 6 p. 1570 - 1574 |
|
~%
[4-methoxy-2-[4... CAS#:104712-26-7 |
| Literature: Miyano; Tatsuoka; Suzuki; Imao; Satoh; Ishihara; Hirotsu; Kihara; Hatta; Horikawa; Sumoto Chemical and Pharmaceutical Bulletin, 1990 , vol. 38, # 6 p. 1570 - 1574 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |