Barnidipine structure
|
Common Name | Barnidipine | ||
|---|---|---|---|---|
| CAS Number | 104713-75-9 | Molecular Weight | 491.536 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 614.5±55.0 °C at 760 mmHg | |
| Molecular Formula | C27H29N3O6 | Melting Point | 137-139° | |
| MSDS | N/A | Flash Point | 325.4±31.5 °C | |
Use of BarnidipineBarnidipine (Mepirodipine) is an L-type calcium antagonist (CaA) with high affinity for [3H] initrendipine binding sites (Ki=0.21 nmol/l), has selective action against CaA receptors[1].Barnidipine (Mepirodipine) is an antihypertensive drug and acts by the reduction of peripheral vascular resistance secondary to its vasodilatory action[2]. |
| Name | (+)-(3'S,4S)-1-Benzyl-3-pyrrolidinyl methyl 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Description | Barnidipine (Mepirodipine) is an L-type calcium antagonist (CaA) with high affinity for [3H] initrendipine binding sites (Ki=0.21 nmol/l), has selective action against CaA receptors[1].Barnidipine (Mepirodipine) is an antihypertensive drug and acts by the reduction of peripheral vascular resistance secondary to its vasodilatory action[2]. |
|---|---|
| Related Catalog | |
| Target |
Ki: 0.21 nmol/l ([3H] initrendipine)[1] |
| References |
[2]. Malhotra HS, et al. Barnidipine. Drugs. 2001;61(7):989-96; discussion 997-8. |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 614.5±55.0 °C at 760 mmHg |
| Melting Point | 137-139° |
| Molecular Formula | C27H29N3O6 |
| Molecular Weight | 491.536 |
| Flash Point | 325.4±31.5 °C |
| Exact Mass | 491.205627 |
| PSA | 113.69000 |
| LogP | 4.36 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | VXMOONUMYLCFJD-DHLKQENFSA-N |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC2CCN(Cc3ccccc3)C2)C1c1cccc([N+](=O)[O-])c1 |
| Storage condition | -20°C |
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| (+)-(3'S,4S)-1-Benzyl-3-pyrrolidinyl methyl 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylate |
| Barnidipine |
| 3,5-Pyridinedicarboxylic acid, 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-, methyl (3S)-1-(phenylmethyl)-3-pyrrolidinyl ester, (4S)- |
| Hypoca |
| (3S)-1-Benzyl-3-pyrrolidinyl methyl (4S)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydro-3,5-pyridinedicarboxylate |
| (3S)-1-Benzylpyrrolidin-3-yl methyl (4S)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| mepirodipine |
| (4S)-1,4-Dihydro-2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylic acid 5-methyl 3-[(3S)-1-benzylpyrrolidin-3-yl] ester |
| (4S)-2,6-Dimethyl-1,4-dihydro-4-(3-nitrophenyl)pyridine-3,5-dicarboxylic acid 5-methyl 3-[(3S)-1-benzylpyrrolidin-3-yl] ester |
| (S)-3-((S)-1-Benzylpyrrolidin-3-yl) 5-Methyl 2,6-diMethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| [S-(R*,R*)]-1,4-Dihydro-2,6-di methyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylic Acid Methyl 1-(Phenylmethyl)-3-pyrrolidinyl Ester |
| (3S)-1-benzyl-3-pyrrolidinyl methyl (4S)-2,6-dimethyl-4-(m-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |