3-isopropoxy-5-methoxybenzo(b)thiophene-2-carboxamide structure
|
Common Name | 3-isopropoxy-5-methoxybenzo(b)thiophene-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 104796-05-6 | Molecular Weight | 265.32800 | |
| Density | 1.244g/cm3 | Boiling Point | 445.2ºC at 760mmHg | |
| Molecular Formula | C13H15NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.1ºC | |
| Name | 5-methoxy-3-propan-2-yloxy-1-benzothiophene-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.244g/cm3 |
|---|---|
| Boiling Point | 445.2ºC at 760mmHg |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.32800 |
| Flash Point | 223.1ºC |
| Exact Mass | 265.07700 |
| PSA | 90.78000 |
| LogP | 3.68020 |
| Vapour Pressure | 4.02E-08mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | YNXSDBVUOOEWIK-UHFFFAOYSA-N |
| SMILES | COc1ccc2sc(C(N)=O)c(OC(C)C)c2c1 |
| HS Code | 2934999090 |
|---|
|
~%
3-isopropoxy-5-... CAS#:104796-05-6 |
| Literature: Journal of Medicinal Chemistry, , vol. 37, # 6 p. 717 - 718 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Ipro-5-MeO-BZT |