5-methoxy-1-oxo-3-propan-2-yloxy-1-benzothiophene-2-carboxamide structure
|
Common Name | 5-methoxy-1-oxo-3-propan-2-yloxy-1-benzothiophene-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 148550-96-3 | Molecular Weight | 281.32800 | |
| Density | 1.23g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H15NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-methoxy-1-oxo-3-propan-2-yloxy-1-benzothiophene-2-carboxamide |
|---|
| Density | 1.23g/cm3 |
|---|---|
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.32800 |
| Exact Mass | 281.07200 |
| PSA | 101.31000 |
| LogP | 3.56140 |
| Index of Refraction | 1.613 |
| InChIKey | VCBBOEAKKOXRTJ-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)C(OC(C)C)=C(C(N)=O)S2=O |
|
~22%
5-methoxy-1-oxo... CAS#:148550-96-3 |
| Literature: Boschelli; Kramer; Khatana; Serenson; Connor; Ferin; Wright; Lesch; Imre; Okonkwo; Schrier; Conroy; Ferguson; Woelle; Saxena Journal of Medicinal Chemistry, 1995 , vol. 38, # 22 p. 4597 - 4614 |
|
~%
5-methoxy-1-oxo... CAS#:148550-96-3 |
| Literature: Warner-Lambert Company Patent: US5356926 A1, 1994 ; |
|
~%
5-methoxy-1-oxo... CAS#:148550-96-3 |
| Literature: Boschelli; Kramer; Connor; Lesch; Schrier; Ferin; Wright Journal of Medicinal Chemistry, 1994 , vol. 37, # 6 p. 717 - 718 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |