Benzenamine,3-chloro-N-[(3-nitrophenyl)methylene]- structure
|
Common Name | Benzenamine,3-chloro-N-[(3-nitrophenyl)methylene]- | ||
|---|---|---|---|---|
| CAS Number | 10480-27-0 | Molecular Weight | 260.67600 | |
| Density | 1.27g/cm3 | Boiling Point | 421.4ºC at 760 mmHg | |
| Molecular Formula | C13H9ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.6ºC | |
| Name | N-(3-chlorophenyl)-1-(3-nitrophenyl)methanimine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 421.4ºC at 760 mmHg |
| Molecular Formula | C13H9ClN2O2 |
| Molecular Weight | 260.67600 |
| Flash Point | 208.6ºC |
| Exact Mass | 260.03500 |
| PSA | 58.18000 |
| LogP | 4.52200 |
| Vapour Pressure | 6.41E-07mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | OVBDZJKHSCHXBO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(C=Nc2cccc(Cl)c2)c1 |
| HS Code | 2925290090 |
|---|
|
~%
Benzenamine,3-c... CAS#:10480-27-0 |
| Literature: Heller; Schuetze Chemische Berichte, 1927 , vol. 60, p. 911 |
|
~%
Benzenamine,3-c... CAS#:10480-27-0 |
| Literature: Heller; Schuetze Chemische Berichte, 1927 , vol. 60, p. 911 |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| N-<3-Nitro-benzyliden>-3-chlor-anilin |
| <3-Nitro-benzyliden>-<3-chlor-anilin> |
| OVBDZJKHSCHXBO-OQLLNIDSSA |