6-(Methoxycarbonyl)spiro[3.3]heptane-2-carboxylic acid structure
|
Common Name | 6-(Methoxycarbonyl)spiro[3.3]heptane-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 10481-25-1 | Molecular Weight | 198.21600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14O4 | Melting Point | 53-55℃ | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Spiro[3.3]heptane-2,6-dicarboxylic acid monomethyl ester |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 53-55℃ |
|---|---|
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.21600 |
| Exact Mass | 198.08900 |
| PSA | 63.60000 |
| LogP | 1.05040 |
| InChIKey | NNVZYAFUSDVQII-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC2(CC(C(=O)O)C2)C1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-methoxycarbonylspiro[3.3]heptane-6-carboxylic acid |