Phenol,4-[(E)-[(4-methoxyphenyl)methylene]amino]-, 1-acetate structure
|
Common Name | Phenol,4-[(E)-[(4-methoxyphenyl)methylene]amino]-, 1-acetate | ||
|---|---|---|---|---|
| CAS Number | 10484-13-6 | Molecular Weight | 269.29500 | |
| Density | 1.09g/cm3 | Boiling Point | 418.2ºC at 760mmHg | |
| Molecular Formula | C16H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.4ºC | |
| Name | [4-[(4-methoxyphenyl)methylideneamino]phenyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 418.2ºC at 760mmHg |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.29500 |
| Flash Point | 184.4ºC |
| Exact Mass | 269.10500 |
| PSA | 47.89000 |
| LogP | 3.37110 |
| Vapour Pressure | 3.35E-07mmHg at 25°C |
| Index of Refraction | 1.541 |
| InChIKey | HOYWVKUPOCFKOT-UHFFFAOYSA-N |
| SMILES | COc1ccc(C=Nc2ccc(OC(C)=O)cc2)cc1 |
| Safety Phrases | 24/25 |
|---|---|
| HS Code | 2925290090 |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| p-Anisylidene-p-aminophenyl acetate |
| APAPA |
| Anisylidene-p-aminophenyl acetate |
| N-(p-Anisal)-4-acetoxyaniline |
| 4-Acetoxy-N-<4-methoxy-benzyliden>-anilin |
| 4-[(p-Anisylidene)amino]phenyl Acetate |
| 4'-Methoxybenzylidene-4-acetoxyaniline |
| 4-[(4-Methoxybenzylidene)amino]phenyl Acetate |
| 4-Methoxybenzylidene-4'-aminophenyl acetate |
| N-(4-METHOXYBENZYLIDENE)-4-ACETOXYANILINE |