4-(benzoyldioxy)-4-oxobutyric acid structure
|
Common Name | 4-(benzoyldioxy)-4-oxobutyric acid | ||
|---|---|---|---|---|
| CAS Number | 10484-48-7 | Molecular Weight | 238.19300 | |
| Density | 1.361g/cm3 | Boiling Point | 394.4ºC at 760mmHg | |
| Molecular Formula | C11H10O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.2ºC | |
| Name | 4-benzoylperoxy-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.361g/cm3 |
|---|---|
| Boiling Point | 394.4ºC at 760mmHg |
| Molecular Formula | C11H10O6 |
| Molecular Weight | 238.19300 |
| Flash Point | 154.2ºC |
| Exact Mass | 238.04800 |
| PSA | 89.90000 |
| LogP | 1.16640 |
| Vapour Pressure | 6.27E-07mmHg at 25°C |
| Index of Refraction | 1.544 |
| InChIKey | QUZPSMZNTIBYAS-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(=O)OOC(=O)c1ccccc1 |
| HS Code | 2918990090 |
|---|
|
~%
4-(benzoyldioxy... CAS#:10484-48-7 |
| Literature: Weitzel,G. et al. Hoppe-Seyler's Zeitschrift fuer Physiologische Chemie, 1961 , vol. 323, p. 211 - 235 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 233-997-8 |
| Benzoyl-succinyl-monoperoxid |
| Benzoyl-succinyl-peroxid |
| Saures Succin-benzoyl-peroxid |