2-(benzenesulfonyl)-1-phenylpent-4-en-1-one structure
|
Common Name | 2-(benzenesulfonyl)-1-phenylpent-4-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 104869-91-2 | Molecular Weight | 300.37200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(benzenesulfonyl)-1-phenylpent-4-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H16O3S |
|---|---|
| Molecular Weight | 300.37200 |
| Exact Mass | 300.08200 |
| PSA | 59.59000 |
| LogP | 4.36870 |
| InChIKey | QTSWXISMUUIVGM-UHFFFAOYSA-N |
| SMILES | C=CCC(C(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
|
~%
2-(benzenesulfo... CAS#:104869-91-2 |
| Literature: Yan, Xiao-Xia; Liang, Chun-Gen; Zhang, Yan; Hong, Wei; Cao, Bo-Xun; Dai, Li-Xin; Hou, Xue-Long Angewandte Chemie - International Edition, 2005 , vol. 44, # 40 p. 6544 - 6546 |
|
~73%
2-(benzenesulfo... CAS#:104869-91-2 |
| Literature: Fujii, Masayuki; Nakamura, Kaoru; Mekata, Hidevuki; Oka, Shinzaburo; Ohno, Atsuyoshi Bulletin of the Chemical Society of Japan, 1988 , vol. 61, p. 495 - 500 |
| 1-phenyl-2-phenylsulfonyl-4-penten-1-one |
| 2-benzenesulfonyl-1-phenyl-pent-4-en-1-one |