2-(dimethylamino)-3-methyl-1-phenylpent-4-en-1-one structure
|
Common Name | 2-(dimethylamino)-3-methyl-1-phenylpent-4-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 79417-99-5 | Molecular Weight | 217.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(dimethylamino)-3-methyl-1-phenylpent-4-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H19NO |
|---|---|
| Molecular Weight | 217.30700 |
| Exact Mass | 217.14700 |
| PSA | 20.31000 |
| LogP | 2.62160 |
| InChIKey | GSXQOQKFUFVXLV-UHFFFAOYSA-N |
| SMILES | C=CC(C)C(C(=O)c1ccccc1)N(C)C |
|
~%
2-(dimethylamin... CAS#:79417-99-5 |
| Literature: Jemison, Robert W.; Laird, Trevor; Ollis, W. David; Sutherland, Ian O. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 1450 - 1457 |
|
~%
2-(dimethylamin... CAS#:79417-99-5 |
| Literature: Jemison, Robert W.; Laird, Trevor; Ollis, W. David; Sutherland, Ian O. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 1450 - 1457 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HMS1615M12 |
| 4-Penten-1-one,2-(dimethylamino)-3-methyl-1-phenyl |
| 2-dimethylamino-3-methyl-1-phenylpent-4-en-1-one |
| 1-Dimethylamino-2-methyl-buten-(3)-yl-phenylketon |
| HMS2667A03 |