3-methylpent-1-ynyl 4-methoxybenzoate structure
|
Common Name | 3-methylpent-1-ynyl 4-methoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 104911-38-8 | Molecular Weight | 232.27500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methylpent-1-ynyl 4-methoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H16O3 |
|---|---|
| Molecular Weight | 232.27500 |
| Exact Mass | 232.11000 |
| PSA | 35.53000 |
| LogP | 2.85900 |
| InChIKey | UCVMMQXPOUGWNT-UHFFFAOYSA-N |
| SMILES | CCC(C)C#COC(=O)c1ccc(OC)cc1 |
|
~15%
3-methylpent-1-... CAS#:104911-38-8 |
| Literature: Stang,P.J.; Boeshar,M.; Wingert,H. Journal of the American Chemical Society, 1988 , vol. 110, p. 3272 |
|
~%
3-methylpent-1-... CAS#:104911-38-8 |
| Literature: Stang,P.J.; Boeshar,M.; Lin,J. Journal of the American Chemical Society, 1986 , vol. 108, p. 7832 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-methylpentynyl p-methoxybenzoate |
| Benzoic acid,4-methoxy-,3-methyl-1-pentynyl ester |