sodium anisate structure
|
Common Name | sodium anisate | ||
|---|---|---|---|---|
| CAS Number | 536-45-8 | Molecular Weight | 174.12900 | |
| Density | 0.94g/cm3 | Boiling Point | 211.6ºC at 760mmHg | |
| Molecular Formula | C8H7NaO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 84.2ºC | |
| Name | sodium,4-methoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.94g/cm3 |
|---|---|
| Boiling Point | 211.6ºC at 760mmHg |
| Molecular Formula | C8H7NaO3 |
| Molecular Weight | 174.12900 |
| Flash Point | 84.2ºC |
| Exact Mass | 174.02900 |
| PSA | 49.36000 |
| LogP | 0.05870 |
| InChIKey | AETSDHMVQHOYPB-UHFFFAOYSA-M |
| SMILES | COc1ccc(C(=O)[O-])cc1.[Na+] |
| HS Code | 2918990090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Inhibition of human cytosolic carbonic anhydrase 1 by stopped flow CO2 hydration assa...
Source: ChEMBL
Target: Carbonic anhydrase 1
External Id: CHEMBL1762938
|
|
Name: Inhibition of human cytosolic carbonic anhydrase 2 by stopped flow CO2 hydration assa...
Source: ChEMBL
Target: Carbonic anhydrase 2
External Id: CHEMBL1762939
|
|
Name: Inhibition of Cryptococcus neoformans Can2 beta-carbonic anhydrase by stopped flow CO...
Source: ChEMBL
Target: N/A
External Id: CHEMBL1762940
|
|
Name: Inhibition of Candida albicans Nce103 beta-carbonic anhydrase by stopped flow CO2 hyd...
Source: ChEMBL
Target: N/A
External Id: CHEMBL1762941
|
|
Name: Selectivity ratio of Ki for human cytosolic carbonic anhydrase 2 to Ki for Cryptococc...
Source: ChEMBL
Target: N/A
External Id: CHEMBL1762942
|
|
Name: Selectivity ratio of Ki for human cytosolic carbonic anhydrase 2 to Ki for Candida al...
Source: ChEMBL
Target: N/A
External Id: CHEMBL1762943
|
| sodium p-methoxybenzoate |
| NaO2CC6H4-p-OMe |
| sodium 4-methoxyphenylacetate |
| sodium anisate |
| sodium 4-methoxyphenylcarboxylate |
| F9WFJ28MV9 |
| sodium para-methoxybenzoate |
| sodium 4-methoxybenzoate |
| UNII-F9WFJ28MV9 |