1-(4-methoxyphenyl)-2-(1,2,4-triazol-1-yl)prop-2-en-1-one structure
|
Common Name | 1-(4-methoxyphenyl)-2-(1,2,4-triazol-1-yl)prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 104940-92-3 | Molecular Weight | 229.23500 | |
| Density | 1.19g/cm3 | Boiling Point | 436.8ºC at 760 mmHg | |
| Molecular Formula | C12H11N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.9ºC | |
| Name | 1-(4-methoxyphenyl)-2-(1,2,4-triazol-1-yl)prop-2-en-1-one |
|---|
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 436.8ºC at 760 mmHg |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.23500 |
| Flash Point | 217.9ºC |
| Exact Mass | 229.08500 |
| PSA | 57.01000 |
| LogP | 1.64030 |
| Vapour Pressure | 7.89E-08mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | ZNORLGJDLFICNZ-UHFFFAOYSA-N |
| SMILES | C=C(C(=O)c1ccc(OC)cc1)n1cncn1 |
|
~%
1-(4-methoxyphe... CAS#:104940-92-3 |
| Literature: Ogata, Masaru; Matsumoto, Hiroshi; Kida, Shiro; Shimizu, Sumio; Tawara, Katsuya; Kawamura, Yoshimi Journal of Medicinal Chemistry, 1987 , vol. 30, # 8 p. 1497 - 1502 |
|
~%
1-(4-methoxyphe... CAS#:104940-92-3 |
| Literature: Ogata, Masaru; Matsumoto, Hiroshi; Kida, Shiro; Shimizu, Sumio; Tawara, Katsuya; Kawamura, Yoshimi Journal of Medicinal Chemistry, 1987 , vol. 30, # 8 p. 1497 - 1502 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |