methyl 1-[3-(4-chlorophenyl)-3-oxoprop-1-en-2-yl]-6-oxopyridine-3-carboxylate structure
|
Common Name | methyl 1-[3-(4-chlorophenyl)-3-oxoprop-1-en-2-yl]-6-oxopyridine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 104941-01-7 | Molecular Weight | 317.72400 | |
| Density | 1.362g/cm3 | Boiling Point | 497.9ºC at 760mmHg | |
| Molecular Formula | C16H12ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.9ºC | |
| Name | methyl 1-[3-(4-chlorophenyl)-3-oxoprop-1-en-2-yl]-6-oxopyridine-3-carboxylate |
|---|
| Density | 1.362g/cm3 |
|---|---|
| Boiling Point | 497.9ºC at 760mmHg |
| Molecular Formula | C16H12ClNO4 |
| Molecular Weight | 317.72400 |
| Flash Point | 254.9ºC |
| Exact Mass | 317.04500 |
| PSA | 65.37000 |
| LogP | 2.64190 |
| Vapour Pressure | 4.74E-10mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | QREJWGATSUCBEL-UHFFFAOYSA-N |
| SMILES | C=C(C(=O)c1ccc(Cl)cc1)n1cc(C(=O)OC)ccc1=O |
|
~%
methyl 1-[3-(4-... CAS#:104941-01-7 |
| Literature: Ogata, Masaru; Matsumoto, Hiroshi; Kida, Shiro; Shimizu, Sumio; Tawara, Katsuya; Kawamura, Yoshimi Journal of Medicinal Chemistry, 1987 , vol. 30, # 8 p. 1497 - 1502 |
|
~%
methyl 1-[3-(4-... CAS#:104941-01-7 |
| Literature: Ogata, Masaru; Matsumoto, Hiroshi; Kida, Shiro; Shimizu, Sumio; Tawara, Katsuya; Kawamura, Yoshimi Journal of Medicinal Chemistry, 1987 , vol. 30, # 8 p. 1497 - 1502 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |