1-[3-(4-chlorophenyl)-3-oxoprop-1-en-2-yl]quinolin-2-one structure
|
Common Name | 1-[3-(4-chlorophenyl)-3-oxoprop-1-en-2-yl]quinolin-2-one | ||
|---|---|---|---|---|
| CAS Number | 104941-04-0 | Molecular Weight | 309.74600 | |
| Density | 1.323g/cm3 | Boiling Point | 504.8ºC at 760mmHg | |
| Molecular Formula | C18H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.1ºC | |
| Name | 1-[3-(4-chlorophenyl)-3-oxoprop-1-en-2-yl]quinolin-2-one |
|---|
| Density | 1.323g/cm3 |
|---|---|
| Boiling Point | 504.8ºC at 760mmHg |
| Molecular Formula | C18H12ClNO2 |
| Molecular Weight | 309.74600 |
| Flash Point | 259.1ºC |
| Exact Mass | 309.05600 |
| PSA | 39.07000 |
| LogP | 4.00850 |
| Vapour Pressure | 2.58E-10mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | SZIBGMJBUXMXQS-UHFFFAOYSA-N |
| SMILES | C=C(C(=O)c1ccc(Cl)cc1)n1c(=O)ccc2ccccc21 |
|
~%
1-[3-(4-chlorop... CAS#:104941-04-0 |
| Literature: Ogata, Masaru; Matsumoto, Hiroshi; Kida, Shiro; Shimizu, Sumio; Tawara, Katsuya; Kawamura, Yoshimi Journal of Medicinal Chemistry, 1987 , vol. 30, # 8 p. 1497 - 1502 |
|
~%
1-[3-(4-chlorop... CAS#:104941-04-0 |
| Literature: Ogata, Masaru; Matsumoto, Hiroshi; Kida, Shiro; Shimizu, Sumio; Tawara, Katsuya; Kawamura, Yoshimi Journal of Medicinal Chemistry, 1987 , vol. 30, # 8 p. 1497 - 1502 |
|
~%
1-[3-(4-chlorop... CAS#:104941-04-0 |
| Literature: Ogata, Masaru; Matsumoto, Hiroshi; Kida, Shiro; Shimizu, Sumio; Tawara, Katsuya; Kawamura, Yoshimi Journal of Medicinal Chemistry, 1987 , vol. 30, # 8 p. 1497 - 1502 |