1-[2-(4-methoxybenzoyl)prop-2-enyl]pyridin-2-one structure
|
Common Name | 1-[2-(4-methoxybenzoyl)prop-2-enyl]pyridin-2-one | ||
|---|---|---|---|---|
| CAS Number | 104941-13-1 | Molecular Weight | 269.29500 | |
| Density | 1.173g/cm3 | Boiling Point | 506.2ºC at 760mmHg | |
| Molecular Formula | C16H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260ºC | |
| Name | 1-[2-(4-methoxybenzoyl)prop-2-enyl]pyridin-2-one |
|---|
| Density | 1.173g/cm3 |
|---|---|
| Boiling Point | 506.2ºC at 760mmHg |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.29500 |
| Flash Point | 260ºC |
| Exact Mass | 269.10500 |
| PSA | 48.30000 |
| LogP | 2.29600 |
| Vapour Pressure | 2.27E-10mmHg at 25°C |
| Index of Refraction | 1.574 |
| InChIKey | AUXFQZLLLHCCEE-UHFFFAOYSA-N |
| SMILES | C=C(Cn1ccccc1=O)C(=O)c1ccc(OC)cc1 |
|
~%
1-[2-(4-methoxy... CAS#:104941-13-1 |
| Literature: Ogata, Masaru; Matsumoto, Hiroshi; Kida, Shiro; Shimizu, Sumio; Tawara, Katsuya; Kawamura, Yoshimi Journal of Medicinal Chemistry, 1987 , vol. 30, # 8 p. 1497 - 1502 |
|
~%
1-[2-(4-methoxy... CAS#:104941-13-1 |
| Literature: Ogata, Masaru; Matsumoto, Hiroshi; Kida, Shiro; Shimizu, Sumio; Tawara, Katsuya; Kawamura, Yoshimi Journal of Medicinal Chemistry, 1987 , vol. 30, # 8 p. 1497 - 1502 |
|
~%
1-[2-(4-methoxy... CAS#:104941-13-1 |
| Literature: Ogata, Masaru; Matsumoto, Hiroshi; Kida, Shiro; Shimizu, Sumio; Tawara, Katsuya; Kawamura, Yoshimi Journal of Medicinal Chemistry, 1987 , vol. 30, # 8 p. 1497 - 1502 |