1H-1,2,4-Triazol-5-amine,3-phenyl-, hydrochloride (1:1)
Modify Date: 2025-08-26 11:57:08
1H-1,2,4-Triazol-5-amine,3-phenyl-, hydrochloride (1:1) structure
|
Common Name | 1H-1,2,4-Triazol-5-amine,3-phenyl-, hydrochloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 10495-62-2 | Molecular Weight | 196.63700 | |
| Density | 1.315g/cm3 | Boiling Point | 414.4ºC at 760 mmHg | |
| Molecular Formula | C8H9ClN4 | Melting Point | 191-193ºC | |
| MSDS | N/A | Flash Point | 233.7ºC | |
| Name | 5-phenyl-1H-1,2,4-triazol-3-amine,hydrochloride |
|---|
| Density | 1.315g/cm3 |
|---|---|
| Boiling Point | 414.4ºC at 760 mmHg |
| Melting Point | 191-193ºC |
| Molecular Formula | C8H9ClN4 |
| Molecular Weight | 196.63700 |
| Flash Point | 233.7ºC |
| Exact Mass | 196.05200 |
| PSA | 67.59000 |
| LogP | 2.43710 |
| Vapour Pressure | 4.48E-07mmHg at 25°C |
| Index of Refraction | 1.673 |
| InChIKey | GHDWCWCYOZPWHT-UHFFFAOYSA-N |
| SMILES | Cl.Nc1n[nH]c(-c2ccccc2)n1 |
| Hazard Codes | Xi |
|---|
|
~65%
1H-1,2,4-Triazo... CAS#:10495-62-2 |
| Literature: Chernyshev; Tarasova; Chernysheva; Taranushich Russian Journal of Applied Chemistry, 2011 , vol. 84, # 11 p. 1890 - 1896 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |